CAS
6945-68-2 Purity
---
6945-68-2 Purity
---
Inquiry Basket
3-Chloro-2-methoxyisonicotinic acid
CAS
1211584-06-3
Catalog Number
ACM1211584063
Category
Pyridines
Molecular Weight
187.6
Molecular Formula
C7H6ClNO3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the PubChem CID of 3-Chloro-2-methoxyisonicotinic acid?
The PubChem CID of 3-Chloro-2-methoxyisonicotinic acid is 57345875.
What is the molecular formula of 3-Chloro-2-methoxyisonicotinic acid?
The molecular formula of 3-Chloro-2-methoxyisonicotinic acid is C7H6ClNO3.
What are some synonyms for 3-Chloro-2-methoxyisonicotinic acid?
Some synonyms for 3-Chloro-2-methoxyisonicotinic acid are 3-chloro-2-methoxypyridine-4-carboxylic acid and 3-Chloro-2-methoxy-isonicotinic acid.
What is the molecular weight of 3-Chloro-2-methoxyisonicotinic acid?
The molecular weight of 3-Chloro-2-methoxyisonicotinic acid is 187.58 g/mol.
What is the IUPAC name of 3-Chloro-2-methoxyisonicotinic acid?
The IUPAC name of 3-Chloro-2-methoxyisonicotinic acid is 3-chloro-2-methoxypyridine-4-carboxylic acid.
What is the InChI of 3-Chloro-2-methoxyisonicotinic acid?
The InChI of 3-Chloro-2-methoxyisonicotinic acid is InChI=1S/C7H6ClNO3/c1-12-6-5(8)4(7(10)11)2-3-9-6/h2-3H,1H3,(H,10,11).
What is the InChIKey of 3-Chloro-2-methoxyisonicotinic acid?
The InChIKey of 3-Chloro-2-methoxyisonicotinic acid is GLKKQNFVOGCQFU-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Chloro-2-methoxyisonicotinic acid?
The canonical SMILES of 3-Chloro-2-methoxyisonicotinic acid is COC1=NC=CC(=C1Cl)C(=O)O.
What is the CAS number of 3-Chloro-2-methoxyisonicotinic acid?
The CAS number of 3-Chloro-2-methoxyisonicotinic acid is 1211584-06-3.
What is the hydrogen bond acceptor count of 3-Chloro-2-methoxyisonicotinic acid?
The hydrogen bond acceptor count of 3-Chloro-2-methoxyisonicotinic acid is 4.
Recommended Products
