CAS
33284-21-8 Purity
---
33284-21-8 Purity
---
Inquiry Basket
6-Chloro-2-fluoro nicotinic acid
CAS
1211578-46-9
Catalog Number
ACM1211578469
Category
Pyridines
Molecular Weight
175.5
Molecular Formula
C6H3ClFNO2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
6-Chloro-2-fluoropyridine-3-carboxylic acid
What is the molecular formula of 6-Chloro-2-fluoro nicotinic acid?
The molecular formula of 6-Chloro-2-fluoro nicotinic acid is C6H3ClFNO2.
What is the molecular weight of 6-Chloro-2-fluoro nicotinic acid?
The molecular weight of 6-Chloro-2-fluoro nicotinic acid is 175.54 g/mol.
What are some synonyms for 6-Chloro-2-fluoro nicotinic acid?
Some synonyms for 6-Chloro-2-fluoro nicotinic acid are 6-Chloro-2-fluoronicotinic acid, 6-chloro-2-fluoropyridine-3-carboxylic acid, and 6-chloro-2-fluoronicotinicacid.
When was 6-Chloro-2-fluoro nicotinic acid first created?
6-Chloro-2-fluoro nicotinic acid was first created on May 31, 2013.
What is the Canonical SMILES representation of 6-Chloro-2-fluoro nicotinic acid?
The Canonical SMILES representation of 6-Chloro-2-fluoro nicotinic acid is C1=CC(=NC(=C1C(=O)O)F)Cl.
What is the InChIKey of 6-Chloro-2-fluoro nicotinic acid?
The InChIKey of 6-Chloro-2-fluoro nicotinic acid is GSSVAHBRTISODE-UHFFFAOYSA-N.
What is the XLogP3-AA value of 6-Chloro-2-fluoro nicotinic acid?
The XLogP3-AA value of 6-Chloro-2-fluoro nicotinic acid is 1.8.
How many hydrogen bond acceptors does 6-Chloro-2-fluoro nicotinic acid have?
6-Chloro-2-fluoro nicotinic acid has 4 hydrogen bond acceptors.
What is the topological polar surface area of 6-Chloro-2-fluoro nicotinic acid?
The topological polar surface area of 6-Chloro-2-fluoro nicotinic acid is 50.2?2.
Is 6-Chloro-2-fluoro nicotinic acid considered as a canonicalized compound?
Yes, 6-Chloro-2-fluoro nicotinic acid is considered as a canonicalized compound.
Recommended Products
