CAS
202865-83-6 Purity
---
202865-83-6 Purity
---
Inquiry Basket
3-Bromo-2-chloro-6-fluorotoluene
CAS
203302-92-5
Catalog Number
ACM203302925
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-Bromo-2-chloro-6-fluorotoluene?
The molecular formula of 3-Bromo-2-chloro-6-fluorotoluene is C7H5BrClF.
What is the molecular weight of 3-Bromo-2-chloro-6-fluorotoluene?
The molecular weight of 3-Bromo-2-chloro-6-fluorotoluene is 223.47 g/mol.
What is the IUPAC name of 3-Bromo-2-chloro-6-fluorotoluene?
The IUPAC name of 3-Bromo-2-chloro-6-fluorotoluene is 1-bromo-2-chloro-4-fluoro-3-methylbenzene.
What is the InChI of 3-Bromo-2-chloro-6-fluorotoluene?
The InChI of 3-Bromo-2-chloro-6-fluorotoluene is InChI=1S/C7H5BrClF/c1-4-6(10)3-2-5(8)7(4)9/h2-3H,1H3.
What is the InChIKey of 3-Bromo-2-chloro-6-fluorotoluene?
The InChIKey of 3-Bromo-2-chloro-6-fluorotoluene is VHQALVHKNXDJRY-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-2-chloro-6-fluorotoluene?
The canonical SMILES of 3-Bromo-2-chloro-6-fluorotoluene is CC1=C(C=CC(=C1Cl)Br)F.
What is the CAS number of 3-Bromo-2-chloro-6-fluorotoluene?
The CAS number of 3-Bromo-2-chloro-6-fluorotoluene is 203302-92-5.
What is the XLogP3 value of 3-Bromo-2-chloro-6-fluorotoluene?
The XLogP3 value of 3-Bromo-2-chloro-6-fluorotoluene is 3.6.
How many hydrogen bond donor counts does 3-Bromo-2-chloro-6-fluorotoluene have?
3-Bromo-2-chloro-6-fluorotoluene has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 3-Bromo-2-chloro-6-fluorotoluene have?
3-Bromo-2-chloro-6-fluorotoluene has 1 hydrogen bond acceptor count.
Recommended Products
