CAS
202865-61-0 Purity
---
202865-61-0 Purity
---
Inquiry Basket
4,5-Dibromo-2-fluorotoluene
CAS
202982-77-2
Catalog Number
ACM202982772
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4,5-Dibromo-2-fluorotoluene?
The molecular formula of 4,5-Dibromo-2-fluorotoluene is C7H5Br2F.
What is the molecular weight of 4,5-Dibromo-2-fluorotoluene?
The molecular weight of 4,5-Dibromo-2-fluorotoluene is 267.92 g/mol.
What is the IUPAC name of 4,5-Dibromo-2-fluorotoluene?
The IUPAC name of 4,5-Dibromo-2-fluorotoluene is 1,2-dibromo-4-fluoro-5-methylbenzene.
What is the InChI of 4,5-Dibromo-2-fluorotoluene?
The InChI of 4,5-Dibromo-2-fluorotoluene is InChI=1S/C7H5Br2F/c1-4-2-5(8)6(9)3-7(4)10/h2-3H,1H3.
What is the InChIKey of 4,5-Dibromo-2-fluorotoluene?
The InChIKey of 4,5-Dibromo-2-fluorotoluene is GJHJZTCWLKJMIG-UHFFFAOYSA-N.
What is the canonical SMILES of 4,5-Dibromo-2-fluorotoluene?
The canonical SMILES of 4,5-Dibromo-2-fluorotoluene is CC1=CC(=C(C=C1F)Br)Br.
What is the CAS number of 4,5-Dibromo-2-fluorotoluene?
The CAS number of 4,5-Dibromo-2-fluorotoluene is 202982-77-2.
How many hydrogen bond donor counts does 4,5-Dibromo-2-fluorotoluene have?
4,5-Dibromo-2-fluorotoluene has 0 hydrogen bond donor counts.
How many rotatable bond counts does 4,5-Dibromo-2-fluorotoluene have?
4,5-Dibromo-2-fluorotoluene has 0 rotatable bond counts.
Recommended Products
