CAS
867333-04-8 Purity
---
867333-04-8 Purity
---
Inquiry Basket
2-Fluoro-3-(hydroxymethyl)phenylboronic acid
CAS
1256355-08-4
Catalog Number
ACM1256355084-1
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Fluoro-3-(hydroxymethyl)phenylboronic acid?
The molecular formula of 2-Fluoro-3-(hydroxymethyl)phenylboronic acid is C7H8BFO3.
What are the synonyms for 2-Fluoro-3-(hydroxymethyl)phenylboronic acid?
The synonyms for 2-Fluoro-3-(hydroxymethyl)phenylboronic acid are:
1256355-08-4
2-FLUORO-3-HYDROXYMETHYLPHENYLBORONIC ACID
(2-Fluoro-3-(hydroxymethyl)phenyl)boronic acid
2-fluoro-3-(hydroxymethyl)phenylboronic acid
What is the molecular weight of 2-Fluoro-3-(hydroxymethyl)phenylboronic acid?
The molecular weight of 2-Fluoro-3-(hydroxymethyl)phenylboronic acid is 169.95 g/mol.
What is the IUPAC name of 2-Fluoro-3-(hydroxymethyl)phenylboronic acid?
The IUPAC name of 2-Fluoro-3-(hydroxymethyl)phenylboronic acid is [2-fluoro-3-(hydroxymethyl)phenyl]boronic acid.
What is the InChI of 2-Fluoro-3-(hydroxymethyl)phenylboronic acid?
The InChI of 2-Fluoro-3-(hydroxymethyl)phenylboronic acid is InChI=1S/C7H8BFO3/c9-7-5(4-10)2-1-3-6(7)8(11)12/h1-3,10-12H,4H2.
What is the InChIKey of 2-Fluoro-3-(hydroxymethyl)phenylboronic acid?
The InChIKey of 2-Fluoro-3-(hydroxymethyl)phenylboronic acid is JAVRSTADGYIZFV-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Fluoro-3-(hydroxymethyl)phenylboronic acid?
The Canonical SMILES of 2-Fluoro-3-(hydroxymethyl)phenylboronic acid is B(C1=C(C(=CC=C1)CO)F)(O)O.
What is the CAS number of 2-Fluoro-3-(hydroxymethyl)phenylboronic acid?
The CAS number of 2-Fluoro-3-(hydroxymethyl)phenylboronic acid is 1256355-08-4.
Is 2-Fluoro-3-(hydroxymethyl)phenylboronic acid canonicalized?
Yes, 2-Fluoro-3-(hydroxymethyl)phenylboronic acid is canonicalized.
Recommended Products
CAS
204981-49-7 Purity
---
204981-49-7 Purity
---
