6-Chloro-2-fluoro-3-methoxyphenylboronicacid

• CAS: 867333-04-8
• Catalog Number: ACM867333048
• Category: Boronic Acids
• Molecular Formula: C₇H₇BClFO₃

Custom Q&A

What is the molecular formula of 6-Chloro-2-fluoro-3-methoxyphenylboronic acid?

The molecular formula of 6-Chloro-2-fluoro-3-methoxyphenylboronic acid is C7H7BClFO3.

What is the molecular weight of 6-Chloro-2-fluoro-3-methoxyphenylboronic acid?

The molecular weight of 6-Chloro-2-fluoro-3-methoxyphenylboronic acid is 204.39 g/mol.

What is the IUPAC name of 6-Chloro-2-fluoro-3-methoxyphenylboronic acid?

The IUPAC name of 6-Chloro-2-fluoro-3-methoxyphenylboronic acid is (6-chloro-2-fluoro-3-methoxyphenyl)boronic acid.

What is the InChI of 6-Chloro-2-fluoro-3-methoxyphenylboronic acid?

The InChI of 6-Chloro-2-fluoro-3-methoxyphenylboronic acid is InChI=1S/C7H7BClFO3/c1-13-5-3-2-4(9)6(7(5)10)8(11)12/h2-3,11-12H,1H3.

What is the InChIKey of 6-Chloro-2-fluoro-3-methoxyphenylboronic acid?

The InChIKey of 6-Chloro-2-fluoro-3-methoxyphenylboronic acid is CVKDGGIRBCXOSZ-UHFFFAOYSA-N.

What is the canonical SMILES of 6-Chloro-2-fluoro-3-methoxyphenylboronic acid?

The canonical SMILES of 6-Chloro-2-fluoro-3-methoxyphenylboronic acid is B(C1=C(C=CC(=C1F)OC)Cl)(O)O.

What is the CAS number of 6-Chloro-2-fluoro-3-methoxyphenylboronic acid?

The CAS number of 6-Chloro-2-fluoro-3-methoxyphenylboronic acid is 867333-04-8.

What is the DSSTox Substance ID of 6-Chloro-2-fluoro-3-methoxyphenylboronic acid?

The DSSTox Substance ID of 6-Chloro-2-fluoro-3-methoxyphenylboronic acid is DTXSID40659410.

Is 6-Chloro-2-fluoro-3-methoxyphenylboronic acid a canonicalized compound?

Yes, 6-Chloro-2-fluoro-3-methoxyphenylboronic acid is a canonicalized compound according to PubChem.