CAS
90109-92-5 Purity
---
90109-92-5 Purity
---
Shopping basket
2-Bromo-4-cyanobenzyl alcohol
CAS
90110-98-8
Catalog Number
ACM90110988
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
2-Bromo-4-cyanobenzyl alcohol
What is the molecular formula of the compound?
The molecular formula of the compound is C8H6BrNO.
What is the molecular weight of the compound?
The molecular weight of the compound is 212.04 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 3-bromo-4-(hydroxymethyl)benzonitrile.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H6BrNO/c9-8-3-6(4-10)1-2-7(8)5-11/h1-3,11H,5H2.
What is the InChIKey of the compound?
The InChIKey of the compound is LMKVEJWFFPCGJC-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=C(C=C1C#N)Br)CO.
What is the CAS number of the compound?
The CAS number of the compound is 90110-98-8.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 1.4.
How many hydrogen bond donor count does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor count does the compound have?
The compound has 2 hydrogen bond acceptor count.
Recommended Products
