What is the molecular formula of 1,4-Benzodioxin-6,7-diol,2,3-dihydro according to the reference?
The molecular formula of 1,4-Benzodioxin-6,7-diol,2,3-dihydro is C8H8O4.
When was 1,4-Benzodioxin-6,7-diol,2,3-dihydro created and modified in PubChem?
It was created on 2007-02-08 and modified on 2023-12-30.
What is the IUPAC name of 1,4-Benzodioxin-6,7-diol,2,3-dihydro?
The IUPAC name is 2,3-dihydro-1,4-benzodioxine-6,7-diol.
What is the InChIKey of 1,4-Benzodioxin-6,7-diol,2,3-dihydro?
The InChIKey is OFJMLLBLUIVEIY-UHFFFAOYSA-N.
What is the molecular weight of 1,4-Benzodioxin-6,7-diol,2,3-dihydro?
The molecular weight is 168.15 g/mol.
What is the Canonical SMILES representation of 1,4-Benzodioxin-6,7-diol,2,3-dihydro?
The Canonical SMILES is C1COC2=C(O1)C=C(C(=C2)O)O.
How many hydrogen bond donor counts are there in the structure of 1,4-Benzodioxin-6,7-diol,2,3-dihydro?
There are 2 hydrogen bond donor counts.
What is the topological polar surface area of 1,4-Benzodioxin-6,7-diol,2,3-dihydro?
The topological polar surface area is 58.9 Ų.
How many defined atom stereocenter counts are there in 1,4-Benzodioxin-6,7-diol,2,3-dihydro?
There are 0 defined atom stereocenter counts.
Is the compound canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem.