2,6-Dimethylpyridine-3-boronicacidpinacolester

• CAS: 693774-10-6
• Catalog Number: ACM693774106
• Category: Boronic Esters

Custom Q&A

What is the molecular formula of 2,6-Dimethylpyridine-3-boronicacidpinacolester?

The molecular formula is C13H20BNO2.

What is the molecular weight of 2,6-Dimethylpyridine-3-boronicacidpinacolester?

The molecular weight is 233.12 g/mol.

What is the IUPAC name of 2,6-Dimethylpyridine-3-boronicacidpinacolester?

The IUPAC name is 2,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.

What is the InChI of 2,6-Dimethylpyridine-3-boronicacidpinacolester?

The InChI is InChI=1S/C13H20BNO2/c1-9-7-8-11(10(2)15-9)14-16-12(3,4)13(5,6)17-14/h7-8H,1-6H3.

What is the InChIKey of 2,6-Dimethylpyridine-3-boronicacidpinacolester?

The InChIKey is SKHNRJKSLVTZJH-UHFFFAOYSA-N.

What is the canonical SMILES of 2,6-Dimethylpyridine-3-boronicacidpinacolester?

The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=C(N=C(C=C2)C).

What is the CAS number of 2,6-Dimethylpyridine-3-boronicacidpinacolester?

The CAS number is 693774-10-6.

What is the hydrogen bond donor count of 2,6-Dimethylpyridine-3-boronicacidpinacolester?

The hydrogen bond donor count is 0.

What is the hydrogen bond acceptor count of 2,6-Dimethylpyridine-3-boronicacidpinacolester?

The hydrogen bond acceptor count is 3.

Is 2,6-Dimethylpyridine-3-boronicacidpinacolester a canonicalized compound?

Yes, it is a canonicalized compound.