What is the molecular formula of 2,6-Dimethylpyridine-3-boronicacidpinacolester?
The molecular formula is C13H20BNO2.
What is the molecular weight of 2,6-Dimethylpyridine-3-boronicacidpinacolester?
The molecular weight is 233.12 g/mol.
What is the IUPAC name of 2,6-Dimethylpyridine-3-boronicacidpinacolester?
The IUPAC name is 2,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
What is the InChI of 2,6-Dimethylpyridine-3-boronicacidpinacolester?
The InChI is InChI=1S/C13H20BNO2/c1-9-7-8-11(10(2)15-9)14-16-12(3,4)13(5,6)17-14/h7-8H,1-6H3.
What is the InChIKey of 2,6-Dimethylpyridine-3-boronicacidpinacolester?
The InChIKey is SKHNRJKSLVTZJH-UHFFFAOYSA-N.
What is the canonical SMILES of 2,6-Dimethylpyridine-3-boronicacidpinacolester?
The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=C(N=C(C=C2)C).
What is the CAS number of 2,6-Dimethylpyridine-3-boronicacidpinacolester?
The CAS number is 693774-10-6.
What is the hydrogen bond donor count of 2,6-Dimethylpyridine-3-boronicacidpinacolester?
The hydrogen bond donor count is 0.
What is the hydrogen bond acceptor count of 2,6-Dimethylpyridine-3-boronicacidpinacolester?
The hydrogen bond acceptor count is 3.
Is 2,6-Dimethylpyridine-3-boronicacidpinacolester a canonicalized compound?
Yes, it is a canonicalized compound.