What is the molecular formula of 3,5-Dimethylpyridine-4-boronicacidpinacolester?
The molecular formula is C13H20BNO2.
What is the molecular weight of 3,5-Dimethylpyridine-4-boronicacidpinacolester?
The molecular weight is 233.12 g/mol.
What is the IUPAC name of 3,5-Dimethylpyridine-4-boronicacidpinacolester?
The IUPAC name is 3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
What is the InChI of 3,5-Dimethylpyridine-4-boronicacidpinacolester?
The InChI is InChI=1S/C13H20BNO2/c1-9-7-15-8-10(2)11(9)14-16-12(3,4)13(5,6)17-14/h7-8H,1-6H3.
What is the InChIKey of 3,5-Dimethylpyridine-4-boronicacidpinacolester?
The InChIKey is PLCYEDJFSPVVLL-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Dimethylpyridine-4-boronicacidpinacolester?
The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=C(C=NC=C2C)C.
What is the CAS number of 3,5-Dimethylpyridine-4-boronicacidpinacolester?
The CAS number is 1032358-02-3.
How many hydrogen bond donor counts are there in 3,5-Dimethylpyridine-4-boronicacidpinacolester?
There are 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts are there in 3,5-Dimethylpyridine-4-boronicacidpinacolester?
There are 3 hydrogen bond acceptor counts.
What is the topological polar surface area of 3,5-Dimethylpyridine-4-boronicacidpinacolester?
The topological polar surface area is 31.4Ų.