CAS
38473-89-1 Purity
---
38473-89-1 Purity
---
Inquiry Basket
1-Bromo-2-chloro-3-fluorobenzene
CAS
883499-24-9
Catalog Number
ACM883499249
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 1-Bromo-2-chloro-3-fluorobenzene?
The molecular formula of 1-Bromo-2-chloro-3-fluorobenzene is C6H3BrClF.
What is the molecular weight of 1-Bromo-2-chloro-3-fluorobenzene?
The molecular weight of 1-Bromo-2-chloro-3-fluorobenzene is 209.44 g/mol.
What is the IUPAC name of 1-Bromo-2-chloro-3-fluorobenzene?
The IUPAC name of 1-Bromo-2-chloro-3-fluorobenzene is 1-bromo-2-chloro-3-fluorobenzene.
What is the InChI of 1-Bromo-2-chloro-3-fluorobenzene?
The InChI of 1-Bromo-2-chloro-3-fluorobenzene is InChI=1S/C6H3BrClF/c7-4-2-1-3-5(9)6(4)8/h1-3H.
What is the InChIKey of 1-Bromo-2-chloro-3-fluorobenzene?
The InChIKey of 1-Bromo-2-chloro-3-fluorobenzene is GTIWFNAUYPVPAT-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Bromo-2-chloro-3-fluorobenzene?
The canonical SMILES of 1-Bromo-2-chloro-3-fluorobenzene is C1=CC(=C(C(=C1)Br)Cl)F.
What is the CAS number of 1-Bromo-2-chloro-3-fluorobenzene?
The CAS number of 1-Bromo-2-chloro-3-fluorobenzene is 883499-24-9.
What is the XLogP3-AA value of 1-Bromo-2-chloro-3-fluorobenzene?
The XLogP3-AA value of 1-Bromo-2-chloro-3-fluorobenzene is 3.3.
What is the hydrogen bond donor count of 1-Bromo-2-chloro-3-fluorobenzene?
The hydrogen bond donor count of 1-Bromo-2-chloro-3-fluorobenzene is 0.
Is 1-Bromo-2-chloro-3-fluorobenzene a canonicalized compound?
Yes, 1-Bromo-2-chloro-3-fluorobenzene is a canonicalized compound.
Recommended Products
