3,5-Dibromo-2-methylpyridine

• CAS: 38749-87-0
• Catalog Number: ACM38749870
• Category: Bromine Series
• Molecular Weight: 250.9186
• Molecular Formula: C₆H₅Br₂N

Custom Q&A

What is the molecular formula of 3,5-Dibromo-2-methylpyridine?

The molecular formula of 3,5-Dibromo-2-methylpyridine is C6H5Br2N.

What is the molecular weight of 3,5-Dibromo-2-methylpyridine?

The molecular weight of 3,5-Dibromo-2-methylpyridine is 250.92 g/mol.

What is the IUPAC name of 3,5-Dibromo-2-methylpyridine?

The IUPAC name of 3,5-Dibromo-2-methylpyridine is 3,5-dibromo-2-methylpyridine.

What is the InChI of 3,5-Dibromo-2-methylpyridine?

The InChI of 3,5-Dibromo-2-methylpyridine is InChI=1S/C6H5Br2N/c1-4-6(8)2-5(7)3-9-4/h2-3H,1H3.

What is the InChIKey of 3,5-Dibromo-2-methylpyridine?

The InChIKey of 3,5-Dibromo-2-methylpyridine is HFMNHHLYRNSTSB-UHFFFAOYSA-N.

What is the canonical SMILES representation of 3,5-Dibromo-2-methylpyridine?

The canonical SMILES representation of 3,5-Dibromo-2-methylpyridine is CC1=C(C=C(C=N1)Br)Br.

What is the CAS number of 3,5-Dibromo-2-methylpyridine?

The CAS number of 3,5-Dibromo-2-methylpyridine is 38749-87-0.

What is the EC number of 3,5-Dibromo-2-methylpyridine?

The EC number of 3,5-Dibromo-2-methylpyridine is 696-080-5.

What is the XLogP3-AA value of 3,5-Dibromo-2-methylpyridine?

The XLogP3-AA value of 3,5-Dibromo-2-methylpyridine is 2.6.

Is 3,5-Dibromo-2-methylpyridine a canonicalized compound?

Yes, 3,5-Dibromo-2-methylpyridine is a canonicalized compound.