What is the molecular formula of 1,3-Diethyl-1-(4-nitrophenyl)-3-phenylurea?
The molecular formula is C17H19N3O3.
What are the synonyms for 1,3-Diethyl-1-(4-nitrophenyl)-3-phenylurea?
The synonyms are N,N'-Diethyl-N-(4-nitrophenyl)-N'-phenylurea.
What is the CAS number for 1,3-Diethyl-1-(4-nitrophenyl)-3-phenylurea?
The CAS number is 24827-78-9.
What is the European Community (EC) number for 1,3-Diethyl-1-(4-nitrophenyl)-3-phenylurea?
The EC number is 246-483-3.
What is the IUPAC name for 1,3-Diethyl-1-(4-nitrophenyl)-3-phenylurea?
The IUPAC name is 1,3-diethyl-1-(4-nitrophenyl)-3-phenylurea.
What is the InChI code for 1,3-Diethyl-1-(4-nitrophenyl)-3-phenylurea?
The InChI code is InChI=1S/C17H19N3O3/c1-3-18(14-8-6-5-7-9-14)17(21)19(4-2)15-10-12-16(13-11-15)20(22)23/h5-13H,3-4H2,1-2H3.
What is the molecular weight of 1,3-Diethyl-1-(4-nitrophenyl)-3-phenylurea?
The molecular weight is 313.35 g/mol.
How many hydrogen bond donor count does 1,3-Diethyl-1-(4-nitrophenyl)-3-phenylurea have?
It has 0 hydrogen bond donor count.
How many hydrogen bond acceptor count does 1,3-Diethyl-1-(4-nitrophenyl)-3-phenylurea have?
It has 3 hydrogen bond acceptor count.
How many rotatable bond count does 1,3-Diethyl-1-(4-nitrophenyl)-3-phenylurea have?
It has 4 rotatable bond count.