1,2-Bis(Triethoxysilyl)Ethylene

• CAS: 87061-56-1
• Catalog Number: ACM87061561
• Category: Main Products
• Molecular Weight: 352.57 g/mol
• Molecular Formula: C14H32O6Si2
• Synonyms: 4,4,7,7-TETRAETHOXY-3,8-DIOXA-4,7-DISILADEC-5-ENE
• Packaging: 10 g; 100 g

Custom Reviews

August 24, 2023

---

High quality
The quality of 1,2-bis(triethoxysilyl)ethylene is very good, and the purity meets the requirements, which is very stable.

Custom Q&A

What is the molecular formula of 1,2-bis(triethoxysilyl)ethylene?

The molecular formula is C14H32O6Si2.

What is the molecular weight of 1,2-bis(triethoxysilyl)ethylene?

The molecular weight is 352.57 g/mol.

What is the IUPAC name of 1,2-bis(triethoxysilyl)ethylene?

The IUPAC name is triethoxy-[(E)-2-triethoxysilylethenyl]silane.

What is the InChI of 1,2-bis(triethoxysilyl)ethylene?

The InChI is InChI=1S/C14H32O6Si2/c1-7-15-21(16-8-2,17-9-3)13-14-22(18-10-4,19-11-5)20-12-6/h13-14H,7-12H2,1-6H3/b14-13+.

What is the InChIKey of 1,2-bis(triethoxysilyl)ethylene?

The InChIKey is BTLPDSCJUZOEJB-BUHFOSPRSA-N.

What is the canonical SMILES of 1,2-bis(triethoxysilyl)ethylene?

The canonical SMILES is CCO[Si](C=C[Si](OCC)(OCC)OCC)(OCC)OCC.

What is the isomeric SMILES of 1,2-bis(triethoxysilyl)ethylene?

The isomeric SMILES is CCO[Si](/C=C/[Si](OCC)(OCC)OCC)(OCC)OCC.

What is the hydrogen bond donor count of 1,2-bis(triethoxysilyl)ethylene?

The hydrogen bond donor count is 0.

What is the hydrogen bond acceptor count of 1,2-bis(triethoxysilyl)ethylene?

The hydrogen bond acceptor count is 6.

What is the rotatable bond count of 1,2-bis(triethoxysilyl)ethylene?

The rotatable bond count is 14.