Dichloro(Methyl)[2-(Trichlorosilyl)Ethyl]Silane

• CAS: 15411-19-5
• Catalog Number: ACM15411195
• Category: Main Products
• Molecular Weight: 276.52
• Molecular Formula: C3H7Cl5Si2
• Synonyms: trichloro-[2-[dichloro(methyl)silyl]ethyl]silane
• Appearance: Colorless liquid

Custom Reviews

August 13, 2023

---

Useful lubricant
The addition of dichloro(methyl)[2-(trichlorosilyl)ethyl]silane to lubricating oil can effectively reduce friction and restrain friction within a certain limit.

Custom Q&A

What is the Molecular formula of Dichloro(Methyl)[2-(Trichlorosilyl)Ethyl]Silane?

C3H7Cl5Si2

What is the Molecular weight of Dichloro(Methyl)[2-(Trichlorosilyl)Ethyl]Silane?

276.52

What is the EC number of Dichloro(Methyl)[2-(Trichlorosilyl)Ethyl]Silane?

239-423-2

What is the InChIKey of Dichloro(Methyl)[2-(Trichlorosilyl)Ethyl]Silane?

KQHUBKRXHLPMFV-UHFFFAOYSA-N

What is the SMILES of Dichloro(Methyl)[2-(Trichlorosilyl)Ethyl]Silane?

C[Si](CC[Si](Cl)(Cl)Cl)(Cl)Cl

What is the Appearance of Dichloro(Methyl)[2-(Trichlorosilyl)Ethyl]Silane?

Colorless liquid

What is the Reactivity of Dichloro(Methyl)[2-(Trichlorosilyl)Ethyl]Silane?

Dichloro(methyl)[2-(trichlorosilyl)ethyl]silane is a functionalized organosilicon compound that can undergo various chemical reactions. The trichlorosilyl (-SiCl3) group and the methyl and chloro groups can participate in reactions such as nucleophilic substitution, condensation, and cross-coupling reactions. It can be used as a reagent or building block in organic synthesis to introduce silicon, methyl, or chloro groups into target molecules.

What is the Solubility of Dichloro(Methyl)[2-(Trichlorosilyl)Ethyl]Silane?

This compound is generally insoluble in water. It is soluble in organic solvents such as acetone, chloroform, dichloromethane, and toluene.

What is the Stability of Dichloro(Methyl)[2-(Trichlorosilyl)Ethyl]Silane?

Dichloro(methyl)[2-(trichlorosilyl)ethyl]silane is generally stable under typical handling and storage conditions. However, it should be protected from exposure to moisture or water, as hydrolysis of the trichlorosilyl group can occur, leading to the release of hydrochloric acid.

What is the Application of Dichloro(Methyl)[2-(Trichlorosilyl)Ethyl]Silane?

This compound is commonly used in organic synthesis as a silicon source or as a precursor for the modification of surfaces. It may be employed to functionalize or crosslink polymers, enhance adhesion, or introduce silicon-containing groups into organic materials.