Potassium (3-acetylphenyl)trifluoroborate

• CAS: 854906-74-4
• Catalog Number: ACM854906744
• Category: Borate
• Molecular Formula: C8H7 B F3 O . K

Custom Q&A

What is the chemical formula for Potassium (3-acetylphenyl)trifluoroborate?

The chemical formula is C8H7BF3KO.

When was Potassium (3-acetylphenyl)trifluoroborate created in PubChem?

It was created on July 5, 2011.

What is the molecular weight of Potassium (3-acetylphenyl)trifluoroborate?

The molecular weight is 226.05 g/mol.

How many hydrogen bond acceptor counts are there in Potassium (3-acetylphenyl)trifluoroborate?

There are 5 hydrogen bond acceptor counts.

What is the canonical SMILES for Potassium (3-acetylphenyl)trifluoroborate?

[B-](C1=CC(=CC=C1)C(=O)C)(F)(F)F.[K+]

What is the hydrocarbon donor count for Potassium (3-acetylphenyl)trifluoroborate?

The hydrogen bond donor count is 0.

What is the topological polar surface area of Potassium (3-acetylphenyl)trifluoroborate?

The topological polar surface area is 17.1Ų.

How many heavy atoms are there in Potassium (3-acetylphenyl)trifluoroborate?

There are 14 heavy atoms.

Is Potassium (3-acetylphenyl)trifluoroborate a covalently-bonded unit?

Yes, it has a covalently-bonded unit count of 2.

What is the complexity value of Potassium (3-acetylphenyl)trifluoroborate?

The complexity value is 207.