What is the molecular formula of Potassium (2-aminocarbonylphenyl)trifluoroborate?
The molecular formula is C7H6BF3KNO.
What is the molecular weight of Potassium (2-aminocarbonylphenyl)trifluoroborate?
The molecular weight is 227.04 g/mol.
What is the IUPAC name of Potassium (2-aminocarbonylphenyl)trifluoroborate?
The IUPAC name is potassium;(2-carbamoylphenyl)-trifluoroboranuide.
What is the InChI of Potassium (2-aminocarbonylphenyl)trifluoroborate?
The InChI is InChI=1S/C7H6BF3NO.K/c9-8(10,11)6-4-2-1-3-5(6)7(12)13;/h1-4H,(H2,12,13);/q-1;+1.
What is the InChIKey of Potassium (2-aminocarbonylphenyl)trifluoroborate?
The InChIKey is LMAQXOAAOPKOAK-UHFFFAOYSA-N.
What is the canonical SMILES of Potassium (2-aminocarbonylphenyl)trifluoroborate?
The canonical SMILES is [B-](C1=CC=CC=C1C(=O)N)(F)(F)F.[K+].
What is the CAS number of Potassium (2-aminocarbonylphenyl)trifluoroborate?
The CAS number is 850623-70-0.
What is the hydrogen bond donor count of Potassium (2-aminocarbonylphenyl)trifluoroborate?
The hydrogen bond donor count is 1.
What is the hydrogen bond acceptor count of Potassium (2-aminocarbonylphenyl)trifluoroborate?
The hydrogen bond acceptor count is 5.
Is Potassium (2-aminocarbonylphenyl)trifluoroborate a canonicalized compound?
Yes, Potassium (2-aminocarbonylphenyl)trifluoroborate is canonicalized.