N-Isopropyl-2-methyl-1-propanamine hydrochloride

• Catalog Number: ACMA00000746
• Category: Amine Salts
• Molecular Weight: 151.68
• Molecular Formula: C₇H₁₆ClN
• Hazard Statements: H302
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of N-Isopropyl-2-methyl-1-propanamine hydrochloride?

The molecular formula is C7H18ClN.

What is the molecular weight of N-Isopropyl-2-methyl-1-propanamine hydrochloride?

The molecular weight is 151.68 g/mol.

What is the IUPAC name of N-Isopropyl-2-methyl-1-propanamine hydrochloride?

The IUPAC name is 2-methyl-N-propan-2-ylpropan-1-amine hydrochloride.

What is the InChI of N-Isopropyl-2-methyl-1-propanamine hydrochloride?

The InChI is InChI=1S/C7H17N.ClH/c1-6(2)5-8-7(3)4;/h6-8H,5H2,1-4H3;1H.

What is the InChIKey of N-Isopropyl-2-methyl-1-propanamine hydrochloride?

The InChIKey is MQBUMZZSHWKKJZ-UHFFFAOYSA-N.

What is the Canonical SMILES of N-Isopropyl-2-methyl-1-propanamine hydrochloride?

The Canonical SMILES is CC(C)CNC(C)C.Cl.

What is the hydrogen bond donor count of N-Isopropyl-2-methyl-1-propanamine hydrochloride?

The hydrogen bond donor count is 2.

What is the hydrogen bond acceptor count of N-Isopropyl-2-methyl-1-propanamine hydrochloride?

The hydrogen bond acceptor count is 1.

How many rotatable bonds are present in N-Isopropyl-2-methyl-1-propanamine hydrochloride?

There are 3 rotatable bonds.

What is the topological polar surface area of N-Isopropyl-2-methyl-1-propanamine hydrochloride?

The topological polar surface area is 12Ų.