What is the molecular formula of N-Boc-2-amino-5-bromothiazole-4-carboxylic acid?
The molecular formula is C9H11BrN2O4S.
What is the PubChem CID of N-Boc-2-amino-5-bromothiazole-4-carboxylic acid?
The PubChem CID is 45036914.
What is the molecular weight of N-Boc-2-amino-5-bromothiazole-4-carboxylic acid?
The molecular weight is 323.17 g/mol.
What is the IUPAC name of N-Boc-2-amino-5-bromothiazole-4-carboxylic acid?
The IUPAC name is 5-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-4-carboxylic acid.
What is the InChI of N-Boc-2-amino-5-bromothiazole-4-carboxylic acid?
The InChI is InChI=1S/C9H11BrN2O4S/c1-9(2,3)16-8(15)12-7-11-4(6(13)14)5(10)17-7/h1-3H3,(H,13,14)(H,11,12,15).
What is the InChIKey of N-Boc-2-amino-5-bromothiazole-4-carboxylic acid?
The InChIKey is HESQBOBWSLEMLZ-UHFFFAOYSA-N.
What is the canonical SMILES of N-Boc-2-amino-5-bromothiazole-4-carboxylic acid?
The canonical SMILES is CC(C)(C)OC(=O)NC1=NC(=C(S1)Br)C(=O)O.
What is the CAS number of N-Boc-2-amino-5-bromothiazole-4-carboxylic acid?
The CAS number is 914347-09-4.
What is the molecular weight of N-Boc-2-amino-5-bromothiazole-4-carboxylic acid according to PubChem?
The molecular weight is 323.17 g/mol.
Is N-Boc-2-amino-5-bromothiazole-4-carboxylic acid a canonicalized compound according to PubChem?
Yes, the compound is canonicalized according to PubChem.