5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester

• CAS: 914347-21-0
• Catalog Number: ACM914347210
• Category: Bromine Series
• Molecular Weight: 312.18
• Molecular Formula: C₁₂H₁₀BrNO₂S
• Synonyms: 5-BROMO-2-PHENYLTHIAZOLE-4-CARBOXYLIC ACID ETHYL ESTER;Ethyl 5-bromo-2-phenylthiazole-4-carboxylate

Custom Q&A

What is the molecular weight of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester?

The molecular weight of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester is 312.18 g/mol.

What is the IUPAC name of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester?

The IUPAC name of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester is ethyl 5-bromo-2-phenyl-1,3-thiazole-4-carboxylate.

What is the InChI of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester?

The InChI of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester is InChI=1S/C12H10BrNO2S/c1-2-16-12(15)9-10(13)17-11(14-9)8-6-4-3-5-7-8/h3-7H,2H2,1H3.

What is the InChIKey of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester?

The InChIKey of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester is ONAJVAODOMRERW-UHFFFAOYSA-N.

What is the Canonical SMILES of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester?

The Canonical SMILES of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester is CCOC(=O)C1=C(SC(=N1)C2=CC=CC=C2)Br.

What is the CAS number of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester?

The CAS number of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester is 914347-21-0.

What is the XLogP3-AA value of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester?

The XLogP3-AA value of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester is 4.2.

How many hydrogen bond donor counts does 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester have?

5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester have?

5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester has 4 hydrogen bond acceptor counts.