N-(2-Methoxyethyl)hydrazinecarbothioamide

• Catalog Number: ACMA00001622
• Category: Aryl
• Molecular Weight: 149.21
• Molecular Formula: C₁₉H₁₃Br
• Hazard Statements: H314
• RIDADR: UN 2735PSN1 8 / PGII
• Symbol: GHS05

Custom Q&A

What is the molecular formula of N-(2-Methoxyethyl)hydrazinecarbothioamide?

The molecular formula is C4H11N3OS.

What is the PubChem CID of N-(2-Methoxyethyl)hydrazinecarbothioamide?

The PubChem CID is 1810735.

What is the molecular weight of N-(2-Methoxyethyl)hydrazinecarbothioamide?

The molecular weight is 149.22 g/mol.

What is the IUPAC name of N-(2-Methoxyethyl)hydrazinecarbothioamide?

The IUPAC name is 1-amino-3-(2-methoxyethyl)thiourea.

What is the InChI of N-(2-Methoxyethyl)hydrazinecarbothioamide?

The InChI is InChI=1S/C4H11N3OS/c1-8-3-2-6-4(9)7-5/h2-3,5H2,1H3,(H2,6,7,9).

What is the InChIKey of N-(2-Methoxyethyl)hydrazinecarbothioamide?

The InChIKey is CFDHTKSXLMMHIO-UHFFFAOYSA-N.

What is the canonical SMILES of N-(2-Methoxyethyl)hydrazinecarbothioamide?

The canonical SMILES is COCCNC(=S)NN.

What is the CAS number of N-(2-Methoxyethyl)hydrazinecarbothioamide?

The CAS number is 6926-54-1.

Is N-(2-Methoxyethyl)hydrazinecarbothioamide considered a canonicalized compound?

Yes, it is considered a canonicalized compound.