Methyl 5-fluoro-6-methoxynicotinate

• CAS: 953780-40-0
• Catalog Number: ACM953780400
• Category: Pyridines
• Molecular Weight: 185.2
• Molecular Formula: C8H8FNO3

Custom Q&A

What is the molecular formula of Methyl 5-fluoro-6-methoxynicotinate?

The molecular formula is C8H8FNO3.

What is the molecular weight of Methyl 5-fluoro-6-methoxynicotinate?

The molecular weight is 185.15 g/mol.

What is the IUPAC name of Methyl 5-fluoro-6-methoxynicotinate?

The IUPAC name is methyl 5-fluoro-6-methoxypyridine-3-carboxylate.

What is the InChI of Methyl 5-fluoro-6-methoxynicotinate?

The InChI is InChI=1S/C8H8FNO3/c1-12-7-6(9)3-5(4-10-7)8(11)13-2/h3-4H,1-2H3.

What is the InChIKey of Methyl 5-fluoro-6-methoxynicotinate?

The InChIKey is HJBPCUZDKHCJRR-UHFFFAOYSA-N.

What is the canonical SMILES of Methyl 5-fluoro-6-methoxynicotinate?

The canonical SMILES is COC1=C(C=C(C=N1)C(=O)OC)F.

What is the XLogP3-AA value of Methyl 5-fluoro-6-methoxynicotinate?

The XLogP3-AA value is 1.1.

How many hydrogen bond donor counts does Methyl 5-fluoro-6-methoxynicotinate have?

Methyl 5-fluoro-6-methoxynicotinate has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does Methyl 5-fluoro-6-methoxynicotinate have?

Methyl 5-fluoro-6-methoxynicotinate has 5 hydrogen bond acceptor counts.

What is the topological polar surface area of Methyl 5-fluoro-6-methoxynicotinate?

The topological polar surface area is 48.4 Å2.