What is the molecular formula of 2,6-Dichloro-isonicotinic acid ethyl ester?
The molecular formula is C8H7Cl2NO2.
What is the molecular weight of 2,6-Dichloro-isonicotinic acid ethyl ester?
The molecular weight is 220.05 g/mol.
What is the IUPAC name of 2,6-Dichloro-isonicotinic acid ethyl ester?
The IUPAC name is ethyl 2,6-dichloropyridine-4-carboxylate.
What is the InChI of 2,6-Dichloro-isonicotinic acid ethyl ester?
The InChI is InChI=1S/C8H7Cl2NO2/c1-2-13-8(12)5-3-6(9)11-7(10)4-5/h3-4H,2H2,1H3.
What is the InChIKey of 2,6-Dichloro-isonicotinic acid ethyl ester?
The InChIKey is PVPBMYSZXFNZOM-UHFFFAOYSA-N.
What is the canonical SMILES of 2,6-Dichloro-isonicotinic acid ethyl ester?
The canonical SMILES is CCOC(=O)C1=CC(=NC(=C1)Cl)Cl.
What is the CAS number of 2,6-Dichloro-isonicotinic acid ethyl ester?
The CAS number is 1604-14-4.
What is the European Community (EC) number of 2,6-Dichloro-isonicotinic acid ethyl ester?
The European Community (EC) number is 692-310-3.
What is the DSSTox Substance ID of 2,6-Dichloro-isonicotinic acid ethyl ester?
The DSSTox Substance ID is DTXSID20166874.
Is 2,6-Dichloro-isonicotinic acid ethyl ester a canonicalized compound?
Yes, it is canonicalized according to PubChem.