Methyl 2,2-difluoro-2-(fluorosulfonyl)acetate

• CAS: 680-15-9
• Catalog Number: ACM680159
• Category: Other Fluorinated Organic Building Blocks
• Molecular Weight: 192.11
• Hazard Statements: H314
• RIDADR: UN 3261 8 / PGII
• Symbol: GHS05

Custom Q&A

What is the molecular formula of Methyl 2,2-difluoro-2-(fluorosulfonyl)acetate?

The molecular formula is C3H3F3O4S.

What is the molecular weight of Methyl 2,2-difluoro-2-(fluorosulfonyl)acetate?

The molecular weight is 192.12 g/mol.

What are some synonyms for Methyl 2,2-difluoro-2-(fluorosulfonyl)acetate?

Some synonyms include Methyl Fluorosulfonyldifluoroacetate and Methyl difluoro(fluorosulfonyl)acetate.

What is the InChIKey for Methyl 2,2-difluoro-2-(fluorosulfonyl)acetate?

The InChIKey is GQJCAQADCPTHKN-UHFFFAOYSA-N.

What is the Canonical SMILES representation of Methyl 2,2-difluoro-2-(fluorosulfonyl)acetate?

The Canonical SMILES is COC(=O)C(F)(F)S(=O)(=O)F.

What is the CAS number for Methyl 2,2-difluoro-2-(fluorosulfonyl)acetate?

The CAS number is 680-15-9.

How many hydrogen bond acceptors does Methyl 2,2-difluoro-2-(fluorosulfonyl)acetate have?

It has 7 hydrogen bond acceptors.

What is the topological polar surface area of Methyl 2,2-difluoro-2-(fluorosulfonyl)acetate?

The topological polar surface area is 68.8 Å2.

How many rotatable bonds does Methyl 2,2-difluoro-2-(fluorosulfonyl)acetate have?

It has 3 rotatable bonds.

Is Methyl 2,2-difluoro-2-(fluorosulfonyl)acetate a canonicalized compound?

Yes, the compound is canonicalized.