2,5-Difluorobenzenesulfonyl fluoride

• CAS: 62094-86-4
• Catalog Number: ACM62094864
• Category: Other Fluorinated Organic Building Blocks
• Molecular Weight: 196.15
• Molecular Formula: C₆H₃Cl₂FO₂S
• Hazard Statements: H314
• RIDADR: UN 2920 3(8) / PGII
• Symbol: GHS05

Custom Q&A

What is the molecular formula of 2,5-Difluorobenzenesulfonyl fluoride?

The molecular formula of 2,5-Difluorobenzenesulfonyl fluoride is C6H3F3O2S.

What is the molecular weight of 2,5-Difluorobenzenesulfonyl fluoride?

The molecular weight of 2,5-Difluorobenzenesulfonyl fluoride is 196.15 g/mol.

What is the IUPAC Name of 2,5-Difluorobenzenesulfonyl fluoride?

The IUPAC Name of 2,5-Difluorobenzenesulfonyl fluoride is 2,5-difluorobenzenesulfonyl fluoride.

What is the Canonical SMILES notation of 2,5-Difluorobenzenesulfonyl fluoride?

The Canonical SMILES notation of 2,5-Difluorobenzenesulfonyl fluoride is C1=CC(=C(C=C1F)S(=O)(=O)F)F.

What is the InChIKey of 2,5-Difluorobenzenesulfonyl fluoride?

The InChIKey of 2,5-Difluorobenzenesulfonyl fluoride is QHGFXAZDLIJQIV-UHFFFAOYSA-N.

What is the CAS number of 2,5-Difluorobenzenesulfonyl fluoride?

The CAS number of 2,5-Difluorobenzenesulfonyl fluoride is 62094-86-4.

How many hydrogen bond acceptor count does 2,5-Difluorobenzenesulfonyl fluoride have?

2,5-Difluorobenzenesulfonyl fluoride has 5 hydrogen bond acceptor counts.

What is the exact mass of 2,5-Difluorobenzenesulfonyl fluoride?

The exact mass of 2,5-Difluorobenzenesulfonyl fluoride is 195.98058499 g/mol.

Is 2,5-Difluorobenzenesulfonyl fluoride a Canonicalized compound?

Yes, 2,5-Difluorobenzenesulfonyl fluoride is a Canonicalized compound.

How many covalently-bonded unit count does 2,5-Difluorobenzenesulfonyl fluoride have?

2,5-Difluorobenzenesulfonyl fluoride has 1 covalently-bonded unit count.