H-Gly-nme2 acetate

• Catalog Number: ACMA00001333
• Category: Amines
• Molecular Weight: 162.19
• Molecular Formula: C₆H₁₄ClNO₃S
• Hazard Statements: H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of H-Gly-nme2 acetate?

The molecular formula of H-Gly-nme2 acetate is C6H14N2O3.

What is the molecular weight of H-Gly-nme2 acetate?

The molecular weight of H-Gly-nme2 acetate is 162.19 g/mol.

What is the IUPAC name of H-Gly-nme2 acetate?

The IUPAC name of H-Gly-nme2 acetate is acetic acid; 2-amino-N,N-dimethylacetamide.

What is the InChI of H-Gly-nme2 acetate?

The InChI of H-Gly-nme2 acetate is: InChI=1S/C4H10N2O.C2H4O2/c1-6(2)4(7)3-5;1-2(3)4/h3,5H2,1-2H3;1H3,(H,3,4).

What is the InChIKey of H-Gly-nme2 acetate?

The InChIKey of H-Gly-nme2 acetate is BGYVHCTZMBPEBN-UHFFFAOYSA-N.

What is the canonical SMILES of H-Gly-nme2 acetate?

The canonical SMILES of H-Gly-nme2 acetate is CC(=O)O.CN(C)C(=O)CN.

How many hydrogen bond donor counts does H-Gly-nme2 acetate have?

H-Gly-nme2 acetate has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does H-Gly-nme2 acetate have?

H-Gly-nme2 acetate has 4 hydrogen bond acceptor counts.

How many rotatable bond counts does H-Gly-nme2 acetate have?

H-Gly-nme2 acetate has 1 rotatable bond count.

What is the exact mass of H-Gly-nme2 acetate?

The exact mass of H-Gly-nme2 acetate is 162.10044231 g/mol.