Ethyl 2,4-dimethoxybenzoylformate

• Catalog Number: ACMA00002257
• Category: Ethers
• Molecular Weight: 238.24
• Molecular Formula: C₁₂H₁₄O₅
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of ethyl 2,4-dimethoxybenzoylformate?

The molecular formula of ethyl 2,4-dimethoxybenzoylformate is C12H14O5.

What is the PubChem CID of ethyl 2,4-dimethoxybenzoylformate?

The PubChem CID of ethyl 2,4-dimethoxybenzoylformate is 14701395.

What is the IUPAC name of ethyl 2,4-dimethoxybenzoylformate?

The IUPAC name of ethyl 2,4-dimethoxybenzoylformate is ethyl 2-(2,4-dimethoxyphenyl)-2-oxoacetate.

What is the InChI of ethyl 2,4-dimethoxybenzoylformate?

The InChI of ethyl 2,4-dimethoxybenzoylformate is InChI=1S/C12H14O5/c1-4-17-12(14)11(13)9-6-5-8(15-2)7-10(9)16-3/h5-7H,4H2,1-3H3.

What is the molecular weight of ethyl 2,4-dimethoxybenzoylformate?

The molecular weight of ethyl 2,4-dimethoxybenzoylformate is 238.24 g/mol.

What is the XLogP3-AA value of ethyl 2,4-dimethoxybenzoylformate?

The XLogP3-AA value of ethyl 2,4-dimethoxybenzoylformate is 2.

How many hydrogen bond donor counts does ethyl 2,4-dimethoxybenzoylformate have?

Ethyl 2,4-dimethoxybenzoylformate has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does ethyl 2,4-dimethoxybenzoylformate have?

Ethyl 2,4-dimethoxybenzoylformate has 5 hydrogen bond acceptor counts.

How many rotatable bond counts does ethyl 2,4-dimethoxybenzoylformate have?

Ethyl 2,4-dimethoxybenzoylformate has 6 rotatable bond counts.

What is the topological polar surface area (TPSA) of ethyl 2,4-dimethoxybenzoylformate?

The topological polar surface area (TPSA) of ethyl 2,4-dimethoxybenzoylformate is 61.8 Ų.