6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid

• Catalog Number: ACMA00002256
• Category: Ethers
• Molecular Weight: 237.25
• Molecular Formula: C₁₂H₁₄O₅
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid?

The molecular formula is C12H15NO4.

What is the molecular weight of 6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid?

The molecular weight is 237.25 g/mol.

What is the IUPAC name of 6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid?

The IUPAC name is 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid.

What is the InChI of 6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid?

The InChI is InChI=1S/C12H15NO4/c1-16-10-4-7-3-9(12(14)15)13-6-8(7)5-11(10)17-2/h4-5,9,13H,3,6H2,1-2H3,(H,14,15).

What is the InChIKey of 6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid?

The InChIKey is BWYXEHBJIMGDEB-UHFFFAOYSA-N.

What is the canonical SMILES of 6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid?

The canonical SMILES is COC1=C(C=C2CNC(CC2=C1)C(=O)O)OC.

What is the CAS number of 6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid?

The CAS number is 76824-86-7.

What is the XLogP3-AA value of 6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid?

The XLogP3-AA value is -1.4.

How many hydrogen bond donor counts does 6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid have?

It has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid have?

It has 5 hydrogen bond acceptor counts.