99072-87-4 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 4-(2-bromophenyl)pyrimidin-2-amine.
The molecular weight of the compound is 250.09 g/mol.
The InChI of the compound is InChI=1S/C10H8BrN3/c11-8-4-2-1-3-7(8)9-5-6-13-10(12)14-9/h1-6H,(H2,12,13,14).
The InChIKey of the compound is ZCMWKKYYDONJDU-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC=C(C(=C1)C2=NC(=NC=C2)N)Br.
The CAS number of the compound is 99073-95-7.
The XLogP3-AA value of the compound is 2.2.
The compound has 1 hydrogen bond donor.
The compound has 3 hydrogen bond acceptors.
The compound has 1 rotatable bond.