What is the molecular formula of 3-Methyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid hydrazide?
The molecular formula is C10H10N4O2.
What is the PubChem CID of 3-Methyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid hydrazide?
The PubChem CID is 604579.
When was 3-Methyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid hydrazide created?
It was created on March 27, 2005.
What is the IUPAC name of 3-Methyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid hydrazide?
The IUPAC name is 3-methyl-4-oxophthalazine-1-carbohydrazide.
What is the InChI of 3-Methyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid hydrazide?
The InChI is InChI=1S/C10H10N4O2/c1-14-10(16)7-5-3-2-4-6(7)8(13-14)9(15)12-11/h2-5H,11H2,1H3,(H,12,15).
What is the canonical SMILES of 3-Methyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid hydrazide?
The canonical SMILES is CN1C(=O)C2=CC=CC=C2C(=N1)C(=O)NN.
What is the molecular weight of 3-Methyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid hydrazide?
The molecular weight is 218.21 g/mol.
What is the CAS number of 3-Methyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid hydrazide?
The CAS number is 99072-87-4.
How many hydrogen bond donor counts does 3-Methyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid hydrazide have?
It has 2 hydrogen bond donor counts.
Is 3-Methyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid hydrazide a canonicalized compound in PubChem?
Yes, it is a canonicalized compound in PubChem.