98799-27-0 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of Sulforhodamine B 2-acid fluoride is C27H29FN2O6S2.
Sulforhodamine B 2-acid fluoride was first created on 2005-09-14 and last modified on 2023-12-30.
The molecular weight of Sulforhodamine B 2-acid fluoride is 560.7 g/mol.
The IUPAC name of Sulforhodamine B 2-acid fluoride is 4-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-3-fluorosulfonylbenzenesulfonate.
The Canonical SMILES of Sulforhodamine B 2-acid fluoride is CCN(CC)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](CC)CC)C=C3O2)C4=C(C=C(C=C4)S(=O)(=O)[O-])S(=O)(=O)F.
The InChIKey of Sulforhodamine B 2-acid fluoride is OVVHIVNJSALABS-UHFFFAOYSA-N.
Sulforhodamine B 2-acid fluoride has 8 hydrogen bond acceptors.
The topological polar surface area of Sulforhodamine B 2-acid fluoride is 124 Ų.
There is 1 covalently-bonded unit in Sulforhodamine B 2-acid fluoride.
The formal charge of Sulforhodamine B 2-acid fluoride is 0.