What is the molecular formula of Thieno[3,2-b]thiophene-2-carboxylic acid, methyl ester?
The molecular formula is C8H6O2S2.
What is the molecular weight of Thieno[3,2-b]thiophene-2-carboxylic acid, methyl ester?
The molecular weight is 198.3 g/mol.
When was Thieno[3,2-b]thiophene-2-carboxylic acid, methyl ester created and modified in PubChem?
It was created on 2005-07-19 and last modified on 2023-12-30.
What is the IUPAC name of Thieno[3,2-b]thiophene-2-carboxylic acid, methyl ester?
The IUPAC name is methyl thieno[3,2-b]thiophene-5-carboxylate.
What is the InChI key of Thieno[3,2-b]thiophene-2-carboxylic acid, methyl ester?
The InChI key is VCLNJFSCOKHCEJ-UHFFFAOYSA-N.
What is the Canonical SMILES notation for Thieno[3,2-b]thiophene-2-carboxylic acid, methyl ester?
The Canonical SMILES notation is COC(=O)C1=CC2=C(S1)C=CS2.
What is the CAS number for Thieno[3,2-b]thiophene-2-carboxylic acid, methyl ester?
The CAS number is 98800-10-3.
What is the XLogP3-AA value of Thieno[3,2-b]thiophene-2-carboxylic acid, methyl ester?
The XLogP3-AA value is 2.9.
How many hydrogen bond acceptors are there in Thieno[3,2-b]thiophene-2-carboxylic acid, methyl ester?
There are 4 hydrogen bond acceptors.
Is Thieno[3,2-b]thiophene-2-carboxylic acid, methyl ester a canonicalized compound according to PubChem?
Yes, it is a canonicalized compound.