98156-55-9 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H7Br2N3O.
The PubChem CID of the compound is 739373.
The IUPAC name of the compound is 1-(2,4-dibromophenyl)-2-(1,2,4-triazol-1-yl)ethanone.
The molecular weight of the compound is 344.99 g/mol.
The Canonical SMILES of the compound is C1=CC(=C(C=C1Br)Br)C(=O)CN2C=NC=N2.
There are 0 hydrogen bond donor atoms in the compound.
There are 3 hydrogen bond acceptor atoms in the compound.
There are 3 rotatable bonds in the compound.
The topological polar surface area of the compound is 47.8 ?^2.
Yes, the compound is canonicalized.