CAS
98155-65-8 Purity
---
98155-65-8 Purity
---
Inquiry Basket
1-(2,4-Dichloro-phenyl)-2-imidazol-1-yl-ethanone hydrochloride
CAS
98164-08-0
Catalog Number
ACM98164080
Category
Other Products
Molecular Weight
291.56096
Molecular Formula
C11H9Cl3N2O
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
1-(2,4-DICHLORO-PHENYL)-2-IMIDAZOL-1-YL-ETHANONE HYDROCHLORIDE;Ethanone, 1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)-, monohydrochloride (9CI)
What is the molecular formula of 1-(2,4-Dichloro-phenyl)-2-imidazol-1-yl-ethanone hydrochloride?
The molecular formula is C11H9Cl3N2O.
What is the molecular weight of 1-(2,4-Dichloro-phenyl)-2-imidazol-1-yl-ethanone hydrochloride?
The molecular weight is 291.6 g/mol.
What is the IUPAC name of 1-(2,4-Dichloro-phenyl)-2-imidazol-1-yl-ethanone hydrochloride?
The IUPAC name is 1-(2,4-dichlorophenyl)-2-imidazol-1-ylethanone;hydrochloride.
What is the InChI of 1-(2,4-Dichloro-phenyl)-2-imidazol-1-yl-ethanone hydrochloride?
The InChI is InChI=1S/C11H8Cl2N2O.ClH/c12-8-1-2-9(10(13)5-8)11(16)6-15-4-3-14-7-15;/h1-5,7H,6H2;1H.
What is the Canonical SMILES of 1-(2,4-Dichloro-phenyl)-2-imidazol-1-yl-ethanone hydrochloride?
The Canonical SMILES is C1=CC(=C(C=C1Cl)Cl)C(=O)CN2C=CN=C2.Cl.
What is the CAS number of 1-(2,4-Dichloro-phenyl)-2-imidazol-1-yl-ethanone hydrochloride?
The CAS number is 98164-08-0.
How many hydrogen bond donor counts does 1-(2,4-Dichloro-phenyl)-2-imidazol-1-yl-ethanone hydrochloride have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 1-(2,4-Dichloro-phenyl)-2-imidazol-1-yl-ethanone hydrochloride have?
It has 2 hydrogen bond acceptor counts.
What is the topological polar surface area of 1-(2,4-Dichloro-phenyl)-2-imidazol-1-yl-ethanone hydrochloride?
The topological polar surface area is 34.9 Ų.
Is 1-(2,4-Dichloro-phenyl)-2-imidazol-1-yl-ethanone hydrochloride considered a canonicalized compound?
Yes, it is considered a canonicalized compound.
Recommended Products
CAS
98165-40-3 Purity
---
98165-40-3 Purity
---
