97752-23-3 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H18O2.
The molecular weight of the compound is 170.25 g/mol.
The IUPAC name of the compound is 2-methylbutyl (Z)-2-methylbut-2-enoate.
The InChI of the compound is InChI=1S/C10H18O2/c1-5-8(3)7-12-10(11)9(4)6-2/h6,8H,5,7H2,1-4H3/b9-6-.
The InChIKey of the compound is DEJJNOHKWLTTKE-TWGQIWQCSA-N.
The canonical SMILES of the compound is CCC(C)COC(=O)C(=CC)C.
The compound has 0 hydrogen bond donor count.
The compound has 2 hydrogen bond acceptor counts.
The compound has 5 rotatable bond counts.
Yes, the compound is canonicalized according to PubChem.