What is the molecular formula of 3-Amino-7-(dimethylamino)-2-methoxyphenoxazin-5-ium formate?
The molecular formula is C16H17N3O4.
What is the molecular weight of 3-Amino-7-(dimethylamino)-2-methoxyphenoxazin-5-ium formate?
The molecular weight is 315.32 g/mol.
When was 3-Amino-7-(dimethylamino)-2-methoxyphenoxazin-5-ium formate created in PubChem?
It was created on August 20, 2009.
What is the IUPAC name of 3-Amino-7-(dimethylamino)-2-methoxyphenoxazin-5-ium formate?
The IUPAC name is (7-amino-8-methoxyphenoxazin-3-ylidene)-dimethylazanium; formate.
What is the InChI of 3-Amino-7-(dimethylamino)-2-methoxyphenoxazin-5-ium formate?
The InChI is InChI=1S/C15H15N3O2.CH2O2/c1-18(2)9-4-5-11-14(6-9)20-15-7-10(16)13(19-3)8-12(15)17-11;2-1-3/h4-8,16H,1-3H3;1H,(H,2,3).
What is the Canonical SMILES of 3-Amino-7-(dimethylamino)-2-methoxyphenoxazin-5-ium formate?
The Canonical SMILES is C[N+](=C1C=CC2=NC3=C(C=C(C(=C3)OC)N)OC2=C1)C.C(=O)[O-].
What is the CAS number of 3-Amino-7-(dimethylamino)-2-methoxyphenoxazin-5-ium formate?
The CAS number is 97752-30-2.
How many hydrogen bond donor counts are there in 3-Amino-7-(dimethylamino)-2-methoxyphenoxazin-5-ium formate?
There is 1 hydrogen bond donor count.
What is the heavy atom count of 3-Amino-7-(dimethylamino)-2-methoxyphenoxazin-5-ium formate?
The heavy atom count is 23.
Is the compound canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem (release 2021.10.14).