2-(1'-Imidazoylsulfonyl)-1,3,5-tri-O-benzoyl-alpha-D-ribofuranose

CAS

97614-42-1

Catalog Number

ACM97614421

Category

Other Products

Molecular Weight

592.57

Molecular Formula

C₂₉H₂₄N₂O₁₀S

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

What is the molecular formula of Testosterone isocaproate?

The molecular formula of Testosterone isocaproate is C25H38O3.

What is the molecular weight of Testosterone isocaproate?

The molecular weight of Testosterone isocaproate is 386.6 g/mol.

What is the IUPAC Name of Testosterone isocaproate?

The IUPAC Name of Testosterone isocaproate is [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] 4-methylpentanoate.

What is the InChI of Testosterone isocaproate?

The InChI of Testosterone isocaproate is InChI=1S/C25H38O3/c1-16(2)5-10-23(27)28-22-9-8-20-19-7-6-17-15-18(26)11-13-24(17,3)21(19)12-14-25(20,22)4/h15-16,19-22H,5-14H2,1-4H3/t19-,20-,21-,22-,24-,25-/m0/s1.

What is the InChIKey of Testosterone isocaproate?

The InChIKey of Testosterone isocaproate is PPYHLSBUTAPNGT-BKWLFHPQSA-N.

What are some of the synonyms for Testosterone isocaproate?

Some synonyms for Testosterone isocaproate are Testosterone isocapronate, 15262-86-9, CHEBI:35001, X8ST05GYDM, and more.

What is the canonical SMILES notation for Testosterone isocaproate?

The canonical SMILES notation for Testosterone isocaproate is CC(C)CCC(=O)OC1CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C.

What is the CAS number for Testosterone isocaproate?

The CAS number for Testosterone isocaproate is 15262-86-9.

What is the XLogP3 value of Testosterone isocaproate?

The XLogP3 value of Testosterone isocaproate is 5.5.

How many hydrogen bond acceptors are there in Testosterone isocaproate?

There are 3 hydrogen bond acceptors in Testosterone isocaproate.