9-7-5337 Purity
95%
If you have any other questions or need other size, please get a quote.
The IUPAC name of the compound is (2-ethyl-4,6-dimethylphenyl)methanol.
The molecular formula of the compound is C11H16O.
The molecular weight of the compound is 164.24 g/mol.
The InChI of the compound is InChI=1S/C11H16O/c1-4-10-6-8(2)5-9(3)11(10)7-12/h5-6,12H,4,7H2,1-3H3.
The InChIKey of the compound is YWBUHVWYYLXBHY-UHFFFAOYSA-N.
The Canonical SMILES of the compound is CCC1=CC(=CC(=C1CO)C)C.
The CAS number of the compound is 97536-12-4.
The XLogP3-AA value of the compound is 2.6.
The compound has 1 hydrogen bond donor count.
The compound has 2 rotatable bond counts.