CAS
97-31-4 Purity
---
97-31-4 Purity
---
Inquiry Basket
Proline,3-fluoro-5-oxo-,methyl ester,trans-(9ci)
CAS
97315-83-8
Catalog Number
ACM97315838
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of Proline,3-fluoro-5-oxo-,methyl ester,trans-(9ci)?
The molecular formula is C6H8FNO3.
What is the PubChem CID of Proline,3-fluoro-5-oxo-,methyl ester,trans-(9ci)?
The PubChem CID is 45115950.
What is the IUPAC name of Proline,3-fluoro-5-oxo-,methyl ester,trans-(9ci)?
The IUPAC name is methyl (2R,3S)-3-fluoro-5-oxopyrrolidine-2-carboxylate.
What is the InChI of Proline,3-fluoro-5-oxo-,methyl ester,trans-(9ci)?
The InChI is InChI=1S/C6H8FNO3/c1-11-6(10)5-3(7)2-4(9)8-5/h3,5H,2H2,1H3,(H,8,9)/t3-,5-/m0/s1.
What is the InChIKey of Proline,3-fluoro-5-oxo-,methyl ester,trans-(9ci)?
The InChIKey is PARZYDSWERTYBB-UCORVYFPSA-N.
What is the canonical SMILES of Proline,3-fluoro-5-oxo-,methyl ester,trans-(9ci)?
The canonical SMILES is COC(=O)C1C(CC(=O)N1)F.
What is the isomeric SMILES of Proline,3-fluoro-5-oxo-,methyl ester,trans-(9ci)?
The isomeric SMILES is COC(=O)[C@@H]1[C@H](CC(=O)N1)F.
What is the molecular weight of Proline,3-fluoro-5-oxo-,methyl ester,trans-(9ci)?
The molecular weight is 161.13 g/mol.
How many hydrogen bond donor counts does Proline,3-fluoro-5-oxo-,methyl ester,trans-(9ci) have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Proline,3-fluoro-5-oxo-,methyl ester,trans-(9ci) have?
It has 4 hydrogen bond acceptor counts.
Recommended Products
