CAS
97310-93-5 Purity
---
97310-93-5 Purity
---
Inquiry Basket
s-Acetyl-N-glycylcysteamine
CAS
97314-05-1
Catalog Number
ACM97314051
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of s-Acetyl-N-glycylcysteamine?
The molecular formula of s-Acetyl-N-glycylcysteamine is C8H13F3N2O4S.
What is the molecular weight of s-Acetyl-N-glycylcysteamine?
The molecular weight of s-Acetyl-N-glycylcysteamine is 290.26 g/mol.
What are the synonyms for s-Acetyl-N-glycylcysteamine?
The synonyms for s-Acetyl-N-glycylcysteamine are 97314-05-1, I-102, and 2-acetylsulfanylethyl-(2-aminoacetyl)azanium;2,2,2-trifluoroacetate.
What is the IUPAC name of s-Acetyl-N-glycylcysteamine?
The IUPAC name of s-Acetyl-N-glycylcysteamine is 2-acetylsulfanylethyl-(2-aminoacetyl)azanium;2,2,2-trifluoroacetate.
What is the InChI of s-Acetyl-N-glycylcysteamine?
The InChI of s-Acetyl-N-glycylcysteamine is InChI=1S/C6H12N2O2S.C2HF3O2/c1-5(9)11-3-2-8-6(10)4-7;3-2(4,5)1(6)7/h2-4,7H2,1H3,(H,8,10);(H,6,7).
What is the InChIKey of s-Acetyl-N-glycylcysteamine?
The InChIKey of s-Acetyl-N-glycylcysteamine is AMQINUQUUDNBGP-UHFFFAOYSA-N.
What is the canonical SMILES of s-Acetyl-N-glycylcysteamine?
The canonical SMILES of s-Acetyl-N-glycylcysteamine is CC(=O)SCC[NH2+]C(=O)CN.C(=O)(C(F)(F)F)[O-].
What is the CAS number of s-Acetyl-N-glycylcysteamine?
The CAS number of s-Acetyl-N-glycylcysteamine is 97314-05-1.
What is the hydrogen bond donor count of s-Acetyl-N-glycylcysteamine?
The hydrogen bond donor count of s-Acetyl-N-glycylcysteamine is 2.
What is the hydrogen bond acceptor count of s-Acetyl-N-glycylcysteamine?
The hydrogen bond acceptor count of s-Acetyl-N-glycylcysteamine is 9.
Recommended Products
CAS
97313-68-3 Purity
96%
97313-68-3 Purity
96%
