What is the molecular formula of 1-Butanone,4-hydroxy-1-(2,4,6-trimethoxyphenyl)?
The molecular formula is C13H18O5.
When was 1-Butanone,4-hydroxy-1-(2,4,6-trimethoxyphenyl) created and modified in PubChem?
It was created on 2007-02-09 and modified on 2023-12-30.
What is the IUPAC name of 1-Butanone,4-hydroxy-1-(2,4,6-trimethoxyphenyl)?
The IUPAC name is 4-hydroxy-1-(2,4,6-trimethoxyphenyl)butan-1-one.
What is the InChI of 1-Butanone,4-hydroxy-1-(2,4,6-trimethoxyphenyl)?
The InChI is InChI=1S/C13H18O5/c1-16-9-7-11(17-2)13(12(8-9)18-3)10(15)5-4-6-14/h7-8,14H,4-6H2,1-3H3.
What is the InChIKey of 1-Butanone,4-hydroxy-1-(2,4,6-trimethoxyphenyl)?
The InChIKey is CCPVPBCKLIVPAY-UHFFFAOYSA-N.
How many hydrogen bond acceptor counts does 1-Butanone,4-hydroxy-1-(2,4,6-trimethoxyphenyl) have?
It has 5 hydrogen bond acceptor counts.
What is the exact mass of 1-Butanone,4-hydroxy-1-(2,4,6-trimethoxyphenyl)?
The exact mass is 254.11542367 g/mol.
How many rotatable bond counts does 1-Butanone,4-hydroxy-1-(2,4,6-trimethoxyphenyl) have?
It has 7 rotatable bond counts.
Is 1-Butanone,4-hydroxy-1-(2,4,6-trimethoxyphenyl) a canonicalized compound?
Yes, it is canonicalized.
What is the topological polar surface area of 1-Butanone,4-hydroxy-1-(2,4,6-trimethoxyphenyl)?
The topological polar surface area is 65?2.