5-(Aminomethyl)-2-Chloropyridine

• CAS: 97004-04-1
• Catalog Number: ACM97004041
• Category: Other Products
• Molecular Weight: 142.59
• Molecular Formula: C₆H₇ClN₂

Custom Q&A

What is the molecular formula of 5-(Aminomethyl)-2-Chloropyridine?

The molecular formula is C6H7ClN2.

What is the molecular weight of 5-(Aminomethyl)-2-Chloropyridine?

The molecular weight is 142.58 g/mol.

What is the IUPAC name of 5-(Aminomethyl)-2-Chloropyridine?

The IUPAC name is (6-chloropyridin-3-yl)methanamine.

What is the InChI of 5-(Aminomethyl)-2-Chloropyridine?

The InChI is InChI=1S/C6H7ClN2/c7-6-2-1-5(3-8)4-9-6/h1-2,4H,3,8H2.

What is the InChIKey of 5-(Aminomethyl)-2-Chloropyridine?

The InChIKey is XPARFBOWIYMLMY-UHFFFAOYSA-N.

What is the canonical SMILES of 5-(Aminomethyl)-2-Chloropyridine?

The canonical SMILES is C1=CC(=NC=C1CN)Cl.

What is the CAS number of 5-(Aminomethyl)-2-Chloropyridine?

The CAS number is 97004-04-1.

What is the EC number of 5-(Aminomethyl)-2-Chloropyridine?

The EC number is 619-497-6.

What is the hydrogen bond donor count of 5-(Aminomethyl)-2-Chloropyridine?

The hydrogen bond donor count is 1.

Is 5-(Aminomethyl)-2-Chloropyridine a canonicalized compound?

Yes, 5-(Aminomethyl)-2-Chloropyridine is canonicalized.