96930-24-4 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 4-Hydroxymethylbenzoic acid is C8H8O3.
The molecular weight of 4-Hydroxymethylbenzoic acid is 152.15 g/mol.
The IUPAC name of 4-Hydroxymethylbenzoic acid is 4-(hydroxymethyl)benzoic acid.
The InChI of 4-Hydroxymethylbenzoic acid is InChI=1S/C8H8O3/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4,9H,5H2,(H,10,11).
The Canonical SMILES of 4-Hydroxymethylbenzoic acid is C1=CC(=CC=C1CO)C(=O)O.
The CAS number of 4-Hydroxymethylbenzoic acid is 3006-96-0.
There are 2 hydrogen bond donor counts in 4-Hydroxymethylbenzoic acid.
There are 3 hydrogen bond acceptor counts in 4-Hydroxymethylbenzoic acid.
The topological polar surface area of 4-Hydroxymethylbenzoic acid is 57.5 ?2.
Yes, 4-Hydroxymethylbenzoic acid is a canonicalized compound.