CAS
96929-05-4 Purity
96%
96929-05-4 Purity
96%
Inquiry Basket
2-Pyrrolidinone,1-(2-methylphenyl)-5-thioxo-
CAS
96933-17-4
Catalog Number
ACM96933174
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C11H11NOS.
What are the synonyms of the compound?
The synonyms of the compound are 96933-17-4 and 5-Thioxo-1-(o-tolyl)pyrrolidin-2-one.
What is the molecular weight of the compound?
The molecular weight of the compound is 205.28 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 1-(2-methylphenyl)-5-sulfanylidenepyrrolidin-2-one.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C11H11NOS/c1-8-4-2-3-5-9(8)12-10(13)6-7-11(12)14/h2-5H,6-7H2,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is YPGCUGCWPOJLSV-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC1=CC=CC=C1N2C(=O)CCC2=S.
What is the XLogP3 value of the compound?
The XLogP3 value of the compound is 0.9.
How many hydrogen bond acceptor count does the compound have?
The compound has 2 hydrogen bond acceptor count.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
CAS
96930-24-4 Purity
---
96930-24-4 Purity
---
