What is the molecular formula of Methanimidamide,N-cyano-N-(cyanomethyl)-N-methyl-(9ci)?
The molecular formula is C5H6N4.
When was the Methanimidamide,N-cyano-N-(cyanomethyl)-N-methyl-(9ci) created?
It was created on March 30, 2010.
What is the IUPAC Name of Methanimidamide,N-cyano-N-(cyanomethyl)-N-methyl-(9ci)?
The IUPAC Name is N'-cyano-N-(cyanomethyl)-N-methylmethanimidamide.
What is the InChI of Methanimidamide,N-cyano-N-(cyanomethyl)-N-methyl-(9ci)?
The InChI is InChI=1S/C5H6N4/c1-9(3-2-6)5-8-4-7/h5H,3H2,1H3.
What is the InChIKey of Methanimidamide,N-cyano-N-(cyanomethyl)-N-methyl-(9ci)?
The InChIKey is LGGGIAGMIUESBA-UHFFFAOYSA-N.
What is the molecular weight of Methanimidamide,N-cyano-N-(cyanomethyl)-N-methyl-(9ci)?
The molecular weight is 122.13 g/mol.
What is the XLogP3-AA value of Methanimidamide,N-cyano-N-(cyanomethyl)-N-methyl-(9ci)?
The XLogP3-AA value is -0.1.
How many hydrogen bond donor counts does Methanimidamide,N-cyano-N-(cyanomethyl)-N-methyl-(9ci) have?
It has 0 hydrogen bond donor counts.
What is the topological polar surface area of Methanimidamide,N-cyano-N-(cyanomethyl)-N-methyl-(9ci)?
The topological polar surface area is 63.2 Ų.
Is Methanimidamide,N-cyano-N-(cyanomethyl)-N-methyl-(9ci) a canonicalized compound?
Yes, it is a canonicalized compound.