96861-65-3 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is (2,4,6-tribromophenyl) 2-hydroxybenzoate.
The InChI of the compound is InChI=1S/C13H7Br3O3/c14-7-5-9(15)12(10(16)6-7)19-13(18)8-3-1-2-4-11(8)17/h1-6,17H.
The InChIKey of the compound is VZWVHUUGXIFDKA-UHFFFAOYSA-N.
The molecular formula of the compound is C13H7Br3O3.
The molecular weight of the compound is 450.90 g/mol.
The CAS number of the compound is 96-87-7.
The EC number of the compound is 202-542-5.
The DSSTox Substance ID of the compound is DTXSID50242074.
The XLogP3 value of the compound is 5.8.
Yes, the compound is canonicalized.