What is the molecular formula of (1alpha,2beta,5alpha)-5-methyl-2-(1-methylethyl)cyclohexyl palmitate?
The molecular formula is C26H50O2.
What is the molecular weight of (1alpha,2beta,5alpha)-5-methyl-2-(1-methylethyl)cyclohexyl palmitate?
The molecular weight is 394.7 g/mol.
When was this compound created in PubChem?
It was created on 2009-08-20.
What is the IUPAC name of this compound?
The IUPAC name is [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] hexadecanoate.
What is the InChI of (1alpha,2beta,5alpha)-5-methyl-2-(1-methylethyl)cyclohexyl palmitate?
The InChI is InChI=1S/C26H50O2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-26(27)28-25-21-23(4)19-20-24(25)22(2)3/h22-25H,5-21H2,1-4H3/t23-,24+,25-/m0/s1.
What is the InChIKey of this compound?
The InChIKey is VGLJQMIPINKCBI-GVAUOCQISA-N.
How many hydrogen bond acceptors are present in (1alpha,2beta,5alpha)-5-methyl-2-(1-methylethyl)cyclohexyl palmitate?
There are 2 hydrogen bond acceptors.
What is the XLogP3-AA value of this compound?
The XLogP3-AA value is 10.9.
How many rotatable bonds are present in (1alpha,2beta,5alpha)-5-methyl-2-(1-methylethyl)cyclohexyl palmitate?
There are 17 rotatable bonds.
How many defined atom stereocenters are present in this compound?
There are 3 defined atom stereocenters.