96097-17-5 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C17H32O2.
The synonyms of the compound are EINECS 306-100-3 and 2-(3,3-Diethoxybuten-1-yl)-1,1,3-trimethylcyclohexane.
The molecular weight of the compound is 268.4 g/mol.
The IUPAC name of the compound is 2-[(E)-3,3-diethoxybut-1-enyl]-1,1,3-trimethylcyclohexane.
The InChI key of the compound is HNVHSPIGJIWWQU-ACCUITESSA-N.
The canonical SMILES of the compound is CCOC(C)(C=CC1C(CCCC1(C)C)C)OCC.
The XLogP3-AA value of the compound is 4.9.
The compound has 0 hydrogen bond donor count.
The compound has 2 hydrogen bond acceptor counts.
The compound has 6 rotatable bond counts.