959237-46-8 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C9H10O3S.
The molecular weight of the compound is 198.24 g/mol.
The IUPAC name of the compound is 5-(oxolan-2-yl)thiophene-2-carboxylic acid.
The InChI of the compound is InChI=1S/C9H10O3S/c10-9(11)8-4-3-7(13-8)6-2-1-5-12-6/h3-4,6H,1-2,5H2,(H,10,11).
The InChIKey of the compound is MTRSGCTYMNSNSD-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1CC(OC1)C2=CC=C(S2)C(=O)O.
The CAS number of the compound is 959237-71-9.
The XLogP3-AA value of the compound is 1.7.
The compound has 1 hydrogen bond donor count.
The compound has 4 hydrogen bond acceptor counts.