What is the molecular formula of 8-Methoxy-2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid?
The molecular formula is C11H11NO4.
What is the molecular weight of 8-Methoxy-2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid?
The molecular weight is 221.21 g/mol.
What is the IUPAC name of 8-Methoxy-2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid?
The IUPAC name is 8-methoxy-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid.
What is the InChI of 8-Methoxy-2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid?
The InChI is InChI=1S/C11H11NO4/c1-16-8-4-2-3-6-7(11(14)15)5-9(13)12-10(6)8/h2-4,7H,5H2,1H3,(H,12,13)(H,14,15).
What is the InChIKey of 8-Methoxy-2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid?
The InChIKey is PSFFRBNBXIMPJH-UHFFFAOYSA-N.
What is the canonical SMILES of 8-Methoxy-2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid?
The canonical SMILES is COC1=CC=CC2=C1NC(=O)CC2C(=O)O.
What is the CAS number of 8-Methoxy-2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid?
The CAS number is 959237-46-8.
What is the DSSTox Substance ID of 8-Methoxy-2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid?
The DSSTox Substance ID is DTXSID60672388.
What is the XLogP3-AA value of 8-Methoxy-2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid?
The XLogP3-AA value is 0.3.
How many hydrogen bond acceptor counts does 8-Methoxy-2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid have?
It has 4 hydrogen bond acceptor counts.